C17H17N3O4 — CID 7985817
[2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] pyrazine-2-carboxylate (PubChem CID 7985817) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] pyrazine-2-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7985817 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [2-oxo-2-[[(2S)-3-oxo-1-phenylbutan-2-yl]amino]ethyl] pyrazine-2-carboxylate |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C17H17N3O4/c1-12(21)14(9-13-5-3-2-4-6-13)20-16(22)11-24-17(23)15-10-18-7-8-19-15/h2-8,10,14H,9,11H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | LGWVBJLJHJSYKP-AWEZNQCLSA-N |
| XLogP | 0.95 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |