C16H20F2N2O5 — CID 2691716
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 2691716) has the molecular formula C16H20F2N2O5 and a molecular weight of 358.34 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2691716 |
| Molecular Formula | C16H20F2N2O5 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H20F2N2O5/c1-10(2)7-8-19-16(23)20-13(21)9-24-14(22)11-5-3-4-6-12(11)25-15(17)18/h3-6,10,15H,7-9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | IAPYXXFOHMINNX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |