C15H15NO — CID 137399592
[2-(2,5-dimethylpyrrol-1-yl)-5-ethynylphenyl]methanol (PubChem CID 137399592) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-(2,5-dimethylpyrrol-1-yl)-5-ethynylphenyl]methanol.
| Compound Name | [2-(2,5-dimethylpyrrol-1-yl)-5-ethynylphenyl]methanol |
|---|---|
| PubChem CID | 137399592 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [2-(2,5-dimethylpyrrol-1-yl)-5-ethynylphenyl]methanol |
| SMILES | C#Cc1ccc(-n2c(C)ccc2C)c(CO)c1 |
| InChI | InChI=1S/C15H15NO/c1-4-13-7-8-15(14(9-13)10-17)16-11(2)5-6-12(16)3/h1,5-9,17H,10H2,2-3H3 |
| InChIKey | ZEDKNHHLZAUOJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|