C24H28N2O — CID 167312296
1-(cyclopentylmethyl)-N-(2-phenylpropan-2-yl)indole-3-carboxamide (PubChem CID 167312296) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-N-(2-phenylpropan-2-yl)indole-3-carboxamide.
| Compound Name | 1-(cyclopentylmethyl)-N-(2-phenylpropan-2-yl)indole-3-carboxamide |
|---|---|
| PubChem CID | 167312296 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-(cyclopentylmethyl)-N-(2-phenylpropan-2-yl)indole-3-carboxamide |
| SMILES | CC(C)(NC(=O)c1cn(CC2CCCC2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O/c1-24(2,19-12-4-3-5-13-19)25-23(27)21-17-26(16-18-10-6-7-11-18)22-15-9-8-14-20(21)22/h3-5,8-9,12-15,17-18H,6-7,10-11,16H2,1-2H3,(H,25,27) |
| InChIKey | XTVQVQOZQDREFO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |