C17H21NO2 — CID 124518894
methyl 1-(cyclohexylmethyl)indole-3-carboxylate (PubChem CID 124518894) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 1-(cyclohexylmethyl)indole-3-carboxylate.
| Compound Name | methyl 1-(cyclohexylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 124518894 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | methyl 1-(cyclohexylmethyl)indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C17H21NO2/c1-20-17(19)15-12-18(11-13-7-3-2-4-8-13)16-10-6-5-9-14(15)16/h5-6,9-10,12-13H,2-4,7-8,11H2,1H3 |
| InChIKey | KNWOMWABRWXHET-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |