C32H34N2O2 — CID 67816317
1-N,4-N-bis(4-tert-butylphenyl)naphthalene-1,4-dicarboxamide (PubChem CID 67816317) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-N,4-N-bis(4-tert-butylphenyl)naphthalene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-tert-butylphenyl)naphthalene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 67816317 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-N,4-N-bis(4-tert-butylphenyl)naphthalene-1,4-dicarboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(C(C)(C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C32H34N2O2/c1-31(2,3)21-11-15-23(16-12-21)33-29(35)27-19-20-28(26-10-8-7-9-25(26)27)30(36)34-24-17-13-22(14-18-24)32(4,5)6/h7-20H,1-6H3,(H,33,35)(H,34,36) |
| InChIKey | VRXLKQIIQATZLD-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |