C35H32N2O2 — CID 11851846
N-[4-(3-acetamidophenyl)phenyl]-4-(4-tert-butylphenyl)naphthalene-1-carboxamide (PubChem CID 11851846) has the molecular formula C35H32N2O2 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[4-(3-acetamidophenyl)phenyl]-4-(4-tert-butylphenyl)naphthalene-1-carboxamide.
| Compound Name | N-[4-(3-acetamidophenyl)phenyl]-4-(4-tert-butylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 11851846 |
| Molecular Formula | C35H32N2O2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-[4-(3-acetamidophenyl)phenyl]-4-(4-tert-butylphenyl)naphthalene-1-carboxamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc(NC(=O)c3ccc(-c4ccc(C(C)(C)C)cc4)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C35H32N2O2/c1-23(38)36-29-9-7-8-26(22-29)24-14-18-28(19-15-24)37-34(39)33-21-20-30(31-10-5-6-11-32(31)33)25-12-16-27(17-13-25)35(2,3)4/h5-22H,1-4H3,(H,36,38)(H,37,39) |
| InChIKey | PYEJEXOSFFEDKT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |