C32H34Br2N4O4 — CID 139078080
1-N,4-N-bis(4-bromophenyl)naphthalene-1,4-dicarboxamide;bis(N,N-dimethylacetamide) (PubChem CID 139078080) has the molecular formula C32H34Br2N4O4 and a molecular weight of 698.46 g/mol. Its IUPAC name is 1-N,4-N-bis(4-bromophenyl)naphthalene-1,4-dicarboxamide;bis(N,N-dimethylacetamide).
| Compound Name | 1-N,4-N-bis(4-bromophenyl)naphthalene-1,4-dicarboxamide;bis(N,N-dimethylacetamide) |
|---|---|
| PubChem CID | 139078080 |
| Molecular Formula | C32H34Br2N4O4 |
| Molecular Weight | 698.46 g/mol |
| Exact Mass | 696.09 |
| IUPAC Name | 1-N,4-N-bis(4-bromophenyl)naphthalene-1,4-dicarboxamide;bis(N,N-dimethylacetamide) |
| SMILES | CC(=O)N(C)C.CC(=O)N(C)C.O=C(Nc1ccc(Br)cc1)c1ccc(C(=O)Nc2ccc(Br)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H16Br2N2O2.2C4H9NO/c25-15-5-9-17(10-6-15)27-23(29)21-13-14-22(20-4-2-1-3-19(20)21)24(30)28-18-11-7-16(26)8-12-18;2*1-4(6)5(2)3/h1-14H,(H,27,29)(H,28,30);2*1-3H3 |
| InChIKey | SBJTTYYKUPCLCG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.46 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |