C21H22N4O4 — CID 46830417
1-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-N-pyridin-4-ylquinoline-3-carboxamide (PubChem CID 46830417) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-N-pyridin-4-ylquinoline-3-carboxamide.
| Compound Name | 1-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-N-pyridin-4-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46830417 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[6-(hydroxyamino)-6-oxohexyl]-4-oxo-N-pyridin-4-ylquinoline-3-carboxamide |
| SMILES | O=C(CCCCCn1cc(C(=O)Nc2ccncc2)c(=O)c2ccccc21)NO |
| InChI | InChI=1S/C21H22N4O4/c26-19(24-29)8-2-1-5-13-25-14-17(20(27)16-6-3-4-7-18(16)25)21(28)23-15-9-11-22-12-10-15/h3-4,6-7,9-12,14,29H,1-2,5,8,13H2,(H,24,26)(H,22,23,28) |
| InChIKey | HCYYYPRITZLBKZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|