C22H26N2O3 — CID 20899802
N-[(2,3-dimethoxyphenyl)methyl]-3-(1-ethylindol-3-yl)propanamide (PubChem CID 20899802) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-3-(1-ethylindol-3-yl)propanamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(1-ethylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 20899802 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-3-(1-ethylindol-3-yl)propanamide |
| SMILES | CCn1cc(CCC(=O)NCc2cccc(OC)c2OC)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O3/c1-4-24-15-17(18-9-5-6-10-19(18)24)12-13-21(25)23-14-16-8-7-11-20(26-2)22(16)27-3/h5-11,15H,4,12-14H2,1-3H3,(H,23,25) |
| InChIKey | AAQQODUBBVVLRP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |