C24H30N2O4 — CID 5165253
N-[4-(1-ethylindol-3-yl)butan-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 5165253) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[4-(1-ethylindol-3-yl)butan-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(1-ethylindol-3-yl)butan-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 5165253 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[4-(1-ethylindol-3-yl)butan-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CCn1cc(CCC(C)NC(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C24H30N2O4/c1-6-26-15-17(19-9-7-8-10-20(19)26)12-11-16(2)25-24(27)18-13-21(28-3)23(30-5)22(14-18)29-4/h7-10,13-16H,6,11-12H2,1-5H3,(H,25,27) |
| InChIKey | VYCMVUWLKHYUPU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |