C30H31NO2 — CID 154688165
2-[(3-methoxyphenyl)methyl]-6-[1-[(2-methylphenyl)methyl]indol-3-yl]hex-1-en-3-one (PubChem CID 154688165) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-6-[1-[(2-methylphenyl)methyl]indol-3-yl]hex-1-en-3-one.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-6-[1-[(2-methylphenyl)methyl]indol-3-yl]hex-1-en-3-one |
|---|---|
| PubChem CID | 154688165 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-6-[1-[(2-methylphenyl)methyl]indol-3-yl]hex-1-en-3-one |
| SMILES | C=C(Cc1cccc(OC)c1)C(=O)CCCc1cn(Cc2ccccc2C)c2ccccc12 |
| InChI | InChI=1S/C30H31NO2/c1-22-10-4-5-12-25(22)20-31-21-26(28-15-6-7-16-29(28)31)13-9-17-30(32)23(2)18-24-11-8-14-27(19-24)33-3/h4-8,10-12,14-16,19,21H,2,9,13,17-18,20H2,1,3H3 |
| InChIKey | PDLHPJNDCMFFPO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|