C21H14F4N2O2 — CID 159109727
(E)-2-cyano-3-[7-fluoro-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid (PubChem CID 159109727) has the molecular formula C21H14F4N2O2 and a molecular weight of 402.35 g/mol. Its IUPAC name is (E)-2-cyano-3-[7-fluoro-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[7-fluoro-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 159109727 |
| Molecular Formula | C21H14F4N2O2 |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (E)-2-cyano-3-[7-fluoro-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid |
| SMILES | Cc1cc(Cn2cc(/C=C(\C#N)C(=O)O)c3cccc(F)c32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F4N2O2/c1-12-5-13(7-16(6-12)21(23,24)25)10-27-11-15(8-14(9-26)20(28)29)17-3-2-4-18(22)19(17)27/h2-8,11H,10H2,1H3,(H,28,29)/b14-8+ |
| InChIKey | XGRGHWTUOSSYNE-RIYZIHGNSA-N |
| XLogP | 5.15 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|