C23H18F3N3O3 — CID 163551828
methyl 3-[(E)-2-cyano-3-oxobut-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 163551828) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is methyl 3-[(E)-2-cyano-3-oxobut-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylate.
| Compound Name | methyl 3-[(E)-2-cyano-3-oxobut-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 163551828 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | methyl 3-[(E)-2-cyano-3-oxobut-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc2c1c(/C=C(\C#N)C(C)=O)cn2Cc1cc(C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F3N3O3/c1-13-6-15(8-18(7-13)23(24,25)26)11-29-12-17(9-16(10-27)14(2)30)20-19(22(31)32-3)4-5-28-21(20)29/h4-9,12H,11H2,1-3H3/b16-9+ |
| InChIKey | HZTNFXJUBMVGNQ-CXUHLZMHSA-N |
| XLogP | 4.69 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|