C21H10ClF6N2O2- — CID 150749227
(E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-chloroindol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 150749227) has the molecular formula C21H10ClF6N2O2- and a molecular weight of 471.76 g/mol. Its IUPAC name is (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-chloroindol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-chloroindol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 150749227 |
| Molecular Formula | C21H10ClF6N2O2- |
| Molecular Weight | 471.76 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-chloroindol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C\c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cccc(Cl)c12)C(=O)[O-] |
| InChI | InChI=1S/C21H11ClF6N2O2/c22-16-2-1-3-17-18(16)13(6-12(8-29)19(31)32)10-30(17)9-11-4-14(20(23,24)25)7-15(5-11)21(26,27)28/h1-7,10H,9H2,(H,31,32)/p-1/b12-6+ |
| InChIKey | JVMVZVULLOFHIM-WUXMJOGZSA-M |
| XLogP | 5.04 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|