C23H17F6N3O2 — CID 162429962
propan-2-yl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate (PubChem CID 162429962) has the molecular formula C23H17F6N3O2 and a molecular weight of 481.40 g/mol. Its IUPAC name is propan-2-yl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | propan-2-yl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 162429962 |
| Molecular Formula | C23H17F6N3O2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | propan-2-yl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
| SMILES | CC(C)OC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncccc12 |
| InChI | InChI=1S/C23H17F6N3O2/c1-13(2)34-21(33)15(10-30)8-16-12-32(20-19(16)4-3-5-31-20)11-14-6-17(22(24,25)26)9-18(7-14)23(27,28)29/h3-9,12-13H,11H2,1-2H3/b15-8+ |
| InChIKey | RMXKBTYVHOFRSJ-OVCLIPMQSA-N |
| XLogP | 5.98 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|