C22H17F3N2O2 — CID 159339145
(E)-2-cyano-3-[6-methyl-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid (PubChem CID 159339145) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is (E)-2-cyano-3-[6-methyl-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[6-methyl-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 159339145 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (E)-2-cyano-3-[6-methyl-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indol-3-yl]prop-2-enoic acid |
| SMILES | Cc1cc(Cn2cc(/C=C(\C#N)C(=O)O)c3ccc(C)cc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N2O2/c1-13-3-4-19-17(9-16(10-26)21(28)29)12-27(20(19)7-13)11-15-5-14(2)6-18(8-15)22(23,24)25/h3-9,12H,11H2,1-2H3,(H,28,29)/b16-9+ |
| InChIKey | LFXMLDVQCYTEFX-CXUHLZMHSA-N |
| XLogP | 5.32 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|