C23H15F6N3O5 — CID 162429988
methoxycarbonyloxymethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate (PubChem CID 162429988) has the molecular formula C23H15F6N3O5 and a molecular weight of 527.38 g/mol. Its IUPAC name is methoxycarbonyloxymethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | methoxycarbonyloxymethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 162429988 |
| Molecular Formula | C23H15F6N3O5 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | methoxycarbonyloxymethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)OCOC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncccc12 |
| InChI | InChI=1S/C23H15F6N3O5/c1-35-21(34)37-12-36-20(33)14(9-30)7-15-11-32(19-18(15)3-2-4-31-19)10-13-5-16(22(24,25)26)8-17(6-13)23(27,28)29/h2-8,11H,10,12H2,1H3/b14-7+ |
| InChIKey | VWDYADXGMDXXAT-VGOFMYFVSA-N |
| XLogP | 5.31 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|