C26H22F6N2O2 — CID 153493865
tert-butyl (E)-3-[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]indol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 153493865) has the molecular formula C26H22F6N2O2 and a molecular weight of 508.46 g/mol. Its IUPAC name is tert-butyl (E)-3-[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]indol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | tert-butyl (E)-3-[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]indol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 153493865 |
| Molecular Formula | C26H22F6N2O2 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | tert-butyl (E)-3-[1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]indol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=C/c1cn(CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C26H22F6N2O2/c1-24(2,3)36-23(35)17(14-33)12-18-15-34(22-7-5-4-6-21(18)22)9-8-16-10-19(25(27,28)29)13-20(11-16)26(30,31)32/h4-7,10-13,15H,8-9H2,1-3H3/b17-12+ |
| InChIKey | BLEPJYBPTIWZOX-SFQUDFHCSA-N |
| XLogP | 7.17 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|