C25H19F6N3O4 — CID 162430004
[(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate (PubChem CID 162430004) has the molecular formula C25H19F6N3O4 and a molecular weight of 539.43 g/mol. Its IUPAC name is [(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 162430004 |
| Molecular Formula | C25H19F6N3O4 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridin-3-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)[C@H](C)OC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncccc12 |
| InChI | InChI=1S/C25H19F6N3O4/c1-3-37-22(35)14(2)38-23(36)16(11-32)9-17-13-34(21-20(17)5-4-6-33-21)12-15-7-18(24(26,27)28)10-19(8-15)25(29,30)31/h4-10,13-14H,3,12H2,1-2H3/b16-9+/t14-/m0/s1 |
| InChIKey | IMFCZJJHPMUHLE-FSEGOYHTSA-N |
| XLogP | 5.52 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|