C23H18F3N3O4 — CID 177208001
3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylic acid (PubChem CID 177208001) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is 3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylic acid.
| Compound Name | 3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 177208001 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]pyrrolo[2,3-b]pyridine-4-carboxylic acid |
| SMILES | CCOC(=O)/C(C#N)=C/c1cn(Cc2cc(C)cc(C(F)(F)F)c2)c2nccc(C(=O)O)c12 |
| InChI | InChI=1S/C23H18F3N3O4/c1-3-33-22(32)15(10-27)9-16-12-29(20-19(16)18(21(30)31)4-5-28-20)11-14-6-13(2)7-17(8-14)23(24,25)26/h4-9,12H,3,11H2,1-2H3,(H,30,31)/b15-9+ |
| InChIKey | JFSDDTMHZGHWTD-OQLLNIDSSA-N |
| XLogP | 4.58 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|