C21H11BrF6N2O2 — CID 137374844
(E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-bromoindol-3-yl]-2-cyanoprop-2-enoic acid (PubChem CID 137374844) has the molecular formula C21H11BrF6N2O2 and a molecular weight of 517.22 g/mol. Its IUPAC name is (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-bromoindol-3-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-bromoindol-3-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 137374844 |
| Molecular Formula | C21H11BrF6N2O2 |
| Molecular Weight | 517.22 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-bromoindol-3-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cccc(Br)c12)C(=O)O |
| InChI | InChI=1S/C21H11BrF6N2O2/c22-16-2-1-3-17-18(16)13(6-12(8-29)19(31)32)10-30(17)9-11-4-14(20(23,24)25)7-15(5-11)21(26,27)28/h1-7,10H,9H2,(H,31,32)/b12-6+ |
| InChIKey | HIYDMSCPEADPJP-WUXMJOGZSA-N |
| XLogP | 6.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.22 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|