C21H11F7N2O2 — CID 137374852
(E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-fluoroindol-3-yl]-2-cyanoprop-2-enoic acid (PubChem CID 137374852) has the molecular formula C21H11F7N2O2 and a molecular weight of 456.32 g/mol. Its IUPAC name is (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-fluoroindol-3-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-fluoroindol-3-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 137374852 |
| Molecular Formula | C21H11F7N2O2 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-fluoroindol-3-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C21H11F7N2O2/c22-16-1-2-17-13(5-12(8-29)19(31)32)10-30(18(17)7-16)9-11-3-14(20(23,24)25)6-15(4-11)21(26,27)28/h1-7,10H,9H2,(H,31,32)/b12-5+ |
| InChIKey | XTPPMHZVOXKVPV-LFYBBSHMSA-N |
| XLogP | 5.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|