C22H15F3N2O4 — CID 147663776
3-[(E)-2-carboxy-2-cyanoethenyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indole-4-carboxylic acid (PubChem CID 147663776) has the molecular formula C22H15F3N2O4 and a molecular weight of 428.37 g/mol. Its IUPAC name is 3-[(E)-2-carboxy-2-cyanoethenyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indole-4-carboxylic acid.
| Compound Name | 3-[(E)-2-carboxy-2-cyanoethenyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 147663776 |
| Molecular Formula | C22H15F3N2O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[(E)-2-carboxy-2-cyanoethenyl]-1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]indole-4-carboxylic acid |
| SMILES | Cc1cc(Cn2cc(/C=C(\C#N)C(=O)O)c3c(C(=O)O)cccc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15F3N2O4/c1-12-5-13(7-16(6-12)22(23,24)25)10-27-11-15(8-14(9-26)20(28)29)19-17(21(30)31)3-2-4-18(19)27/h2-8,11H,10H2,1H3,(H,28,29)(H,30,31)/b14-8+ |
| InChIKey | GLWPBVHDFDOPCK-RIYZIHGNSA-N |
| XLogP | 4.71 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|