C13H10F3NO4 — CID 70354424
(1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 70354424) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is (1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70354424 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (1-ethyl-6,7,8-trifluoro-5-methyl-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | CCn1cc(OC(=O)O)c(=O)c2c(C)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C13H10F3NO4/c1-3-17-4-6(21-13(19)20)12(18)7-5(2)8(14)9(15)10(16)11(7)17/h4H,3H2,1-2H3,(H,19,20) |
| InChIKey | GSPLLYUMMAHVRK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|