C21H24F3N3O4 — CID 70419614
[1-ethyl-7-(7-ethyl-2,7-diazaspiro[4.4]nonan-2-yl)-5,6,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 70419614) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is [1-ethyl-7-(7-ethyl-2,7-diazaspiro[4.4]nonan-2-yl)-5,6,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-ethyl-7-(7-ethyl-2,7-diazaspiro[4.4]nonan-2-yl)-5,6,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70419614 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [1-ethyl-7-(7-ethyl-2,7-diazaspiro[4.4]nonan-2-yl)-5,6,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CCN1CCC2(CCN(c3c(F)c(F)c4c(=O)c(OC(=O)O)cn(CC)c4c3F)C2)C1 |
| InChI | InChI=1S/C21H24F3N3O4/c1-3-25-7-5-21(10-25)6-8-27(11-21)18-15(23)14(22)13-17(16(18)24)26(4-2)9-12(19(13)28)31-20(29)30/h9H,3-8,10-11H2,1-2H3,(H,29,30) |
| InChIKey | ACJCEJDNOUNMKN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|