About (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate
(7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate (PubChem CID 88769690) has the molecular formula C13H10N2O6
and a molecular weight of 290.23 g/mol. Its IUPAC name is (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate |
| PubChem CID | 88769690 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate |
| SMILES | C=CCn1cc(OC(=O)O)c(=O)c2cc(O)c(C=O)nc21 |
| InChI | InChI=1S/C13H10N2O6/c1-2-3-15-5-10(21-13(19)20)11(18)7-4-9(17)8(6-16)14-12(7)15/h2,4-6,17H,1,3H2,(H,19,20) |
| InChIKey | OTMGYPVUHHATOF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate?
The IUPAC name of (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate (CID 88769690) is (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate.
What is the SMILES notation for (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate?
The canonical SMILES for (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate is C=CCn1cc(OC(=O)O)c(=O)c2cc(O)c(C=O)nc21.
What is the InChIKey of (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate?
The InChIKey is OTMGYPVUHHATOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O6/c1-2-3-15-5-10(21-13(19)20)11(18)7-4-9(17)8(6-16)14-12(7)15/h2,4-6,17H,1,3H2,(H,19,20).
What are the key properties of (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate?
(7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate has a molecular weight of 290.23 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-formyl-6-hydroxy-4-oxo-1-prop-2-enyl-1,8-naphthyridin-3-yl) hydrogen carbonate is sourced from PubChem (CID 88769690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).