C14H12N2O6 — CID 70572862
(3-hydroxy-8-oxo-5-prop-2-enyl-2,3-dihydrofuro[3,2-b][1,8]naphthyridin-7-yl) hydrogen carbonate (PubChem CID 70572862) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is (3-hydroxy-8-oxo-5-prop-2-enyl-2,3-dihydrofuro[3,2-b][1,8]naphthyridin-7-yl) hydrogen carbonate.
| Compound Name | (3-hydroxy-8-oxo-5-prop-2-enyl-2,3-dihydrofuro[3,2-b][1,8]naphthyridin-7-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70572862 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (3-hydroxy-8-oxo-5-prop-2-enyl-2,3-dihydrofuro[3,2-b][1,8]naphthyridin-7-yl) hydrogen carbonate |
| SMILES | C=CCn1cc(OC(=O)O)c(=O)c2cc3c(nc21)C(O)CO3 |
| InChI | InChI=1S/C14H12N2O6/c1-2-3-16-5-10(22-14(19)20)12(18)7-4-9-11(15-13(7)16)8(17)6-21-9/h2,4-5,8,17H,1,3,6H2,(H,19,20) |
| InChIKey | YLDCMBGWQWXIHT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|