C13H17NO2 — CID 105421735
ethyl 3-methyl-1-pent-4-ynylpyrrole-2-carboxylate (PubChem CID 105421735) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is ethyl 3-methyl-1-pent-4-ynylpyrrole-2-carboxylate.
| Compound Name | ethyl 3-methyl-1-pent-4-ynylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 105421735 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethyl 3-methyl-1-pent-4-ynylpyrrole-2-carboxylate |
| SMILES | C#CCCCn1ccc(C)c1C(=O)OCC |
| InChI | InChI=1S/C13H17NO2/c1-4-6-7-9-14-10-8-11(3)12(14)13(15)16-5-2/h1,8,10H,5-7,9H2,2-3H3 |
| InChIKey | DVKXMPSVMDSUIS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|