C9H11F2NO2 — CID 178045868
ethyl 3-fluoro-1-(2-fluoroethyl)pyrrole-2-carboxylate (PubChem CID 178045868) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is ethyl 3-fluoro-1-(2-fluoroethyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 3-fluoro-1-(2-fluoroethyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 178045868 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | ethyl 3-fluoro-1-(2-fluoroethyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(F)ccn1CCF |
| InChI | InChI=1S/C9H11F2NO2/c1-2-14-9(13)8-7(11)3-5-12(8)6-4-10/h3,5H,2,4,6H2,1H3 |
| InChIKey | NRWXVBWMZSDXIK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |