C14H21NO4S — CID 87454638
(3-propylmorpholin-4-yl) 4-methylbenzenesulfonate (PubChem CID 87454638) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (3-propylmorpholin-4-yl) 4-methylbenzenesulfonate.
| Compound Name | (3-propylmorpholin-4-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87454638 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3-propylmorpholin-4-yl) 4-methylbenzenesulfonate |
| SMILES | CCCC1COCCN1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-3-4-13-11-18-10-9-15(13)19-20(16,17)14-7-5-12(2)6-8-14/h5-8,13H,3-4,9-11H2,1-2H3 |
| InChIKey | ZWOREAXILNCIEE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |