C12H15NO4S — CID 87566244
(3-oxopiperidin-1-yl) 4-methylbenzenesulfonate (PubChem CID 87566244) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (3-oxopiperidin-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (3-oxopiperidin-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87566244 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3-oxopiperidin-1-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2CCCC(=O)C2)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-10-4-6-12(7-5-10)18(15,16)17-13-8-2-3-11(14)9-13/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | VEROCBGGONSSIN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |