C18H21NO3S — CID 139510290
[3-(3,4-dimethylphenyl)azetidin-1-yl] 4-methylbenzenesulfonate (PubChem CID 139510290) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)azetidin-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-(3,4-dimethylphenyl)azetidin-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139510290 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [3-(3,4-dimethylphenyl)azetidin-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON2CC(c3ccc(C)c(C)c3)C2)cc1 |
| InChI | InChI=1S/C18H21NO3S/c1-13-4-8-18(9-5-13)23(20,21)22-19-11-17(12-19)16-7-6-14(2)15(3)10-16/h4-10,17H,11-12H2,1-3H3 |
| InChIKey | SRSCEXCPXXBMCX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |