C18H24Cl3NO3S — CID 15449537
(3S,4R)-3-chloro-3-(2-chlorohexyl)-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 15449537) has the molecular formula C18H24Cl3NO3S and a molecular weight of 440.82 g/mol. Its IUPAC name is (3S,4R)-3-chloro-3-(2-chlorohexyl)-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | (3S,4R)-3-chloro-3-(2-chlorohexyl)-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15449537 |
| Molecular Formula | C18H24Cl3NO3S |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (3S,4R)-3-chloro-3-(2-chlorohexyl)-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | CCCCC(Cl)C[C@@]1(Cl)C(=O)N(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1CCl |
| InChI | InChI=1S/C18H24Cl3NO3S/c1-3-4-5-15(20)10-18(21)14(11-19)12-22(17(18)23)26(24,25)16-8-6-13(2)7-9-16/h6-9,14-15H,3-5,10-12H2,1-2H3/t14-,15?,18-/m0/s1 |
| InChIKey | XUZZFVVLPHEBNT-RARQCXRASA-N |
| XLogP | 4.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|