C18H29N3O3S — CID 10642745
1,5-dibutyl-3-(4-methylphenyl)sulfonyl-1,3,5-triazinan-2-one (PubChem CID 10642745) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1,5-dibutyl-3-(4-methylphenyl)sulfonyl-1,3,5-triazinan-2-one.
| Compound Name | 1,5-dibutyl-3-(4-methylphenyl)sulfonyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 10642745 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1,5-dibutyl-3-(4-methylphenyl)sulfonyl-1,3,5-triazinan-2-one |
| SMILES | CCCCN1CN(CCCC)C(=O)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H29N3O3S/c1-4-6-12-19-14-20(13-7-5-2)18(22)21(15-19)25(23,24)17-10-8-16(3)9-11-17/h8-11H,4-7,12-15H2,1-3H3 |
| InChIKey | DYWFIVORTAWAMR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |