C20H22N4O2S — CID 7462909
1-butyl-3-(4-methylphenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline (PubChem CID 7462909) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-butyl-3-(4-methylphenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline.
| Compound Name | 1-butyl-3-(4-methylphenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 7462909 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-butyl-3-(4-methylphenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline |
| SMILES | CCCCN1CN(S(=O)(=O)c2ccc(C)cc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C20H22N4O2S/c1-3-4-13-23-14-24(27(25,26)16-11-9-15(2)10-12-16)20-19(23)21-17-7-5-6-8-18(17)22-20/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | TYBKZLJFFZQCHN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |