C19H19ClN4O2S — CID 7528908
1-[(2S)-butan-2-yl]-3-(4-chlorophenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline (PubChem CID 7528908) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-(4-chlorophenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline.
| Compound Name | 1-[(2S)-butan-2-yl]-3-(4-chlorophenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 7528908 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-(4-chlorophenyl)sulfonyl-2H-imidazo[4,5-b]quinoxaline |
| SMILES | CC[C@H](C)N1CN(S(=O)(=O)c2ccc(Cl)cc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-3-13(2)23-12-24(27(25,26)15-10-8-14(20)9-11-15)19-18(23)21-16-6-4-5-7-17(16)22-19/h4-11,13H,3,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | BLNWQWINHKIDFW-ZDUSSCGKSA-N |
| XLogP | 4.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |