C12H13NO5S — CID 54466783
2-[(4S)-3-(4-methylphenyl)sulfonyl-5-oxo-1,3-oxazolidin-4-yl]acetaldehyde (PubChem CID 54466783) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[(4S)-3-(4-methylphenyl)sulfonyl-5-oxo-1,3-oxazolidin-4-yl]acetaldehyde.
| Compound Name | 2-[(4S)-3-(4-methylphenyl)sulfonyl-5-oxo-1,3-oxazolidin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 54466783 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[(4S)-3-(4-methylphenyl)sulfonyl-5-oxo-1,3-oxazolidin-4-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2COC(=O)[C@@H]2CC=O)cc1 |
| InChI | InChI=1S/C12H13NO5S/c1-9-2-4-10(5-3-9)19(16,17)13-8-18-12(15)11(13)6-7-14/h2-5,7,11H,6,8H2,1H3/t11-/m0/s1 |
| InChIKey | XFLIAOXDKLXWOD-NSHDSACASA-N |
| XLogP | 0.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|