C21H35NO3SSi — CID 11133342
[(E)-6-[(2R,5R)-5-methoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]hex-2-enyl]-trimethylsilane (PubChem CID 11133342) has the molecular formula C21H35NO3SSi and a molecular weight of 409.67 g/mol. Its IUPAC name is [(E)-6-[(2R,5R)-5-methoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]hex-2-enyl]-trimethylsilane.
| Compound Name | [(E)-6-[(2R,5R)-5-methoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]hex-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11133342 |
| Molecular Formula | C21H35NO3SSi |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [(E)-6-[(2R,5R)-5-methoxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]hex-2-enyl]-trimethylsilane |
| SMILES | CO[C@@H]1CC[C@@H](CCC/C=C/C[Si](C)(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H35NO3SSi/c1-18-11-14-20(15-12-18)26(23,24)22-19(13-16-21(22)25-2)10-8-6-7-9-17-27(3,4)5/h7,9,11-12,14-15,19,21H,6,8,10,13,16-17H2,1-5H3/b9-7+/t19-,21-/m1/s1 |
| InChIKey | QBWGFKBBMYNUKA-PWIIPBGMSA-N |
| XLogP | 5.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|