C23H19NO2S — CID 139255937
2-(2-ethynylphenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine (PubChem CID 139255937) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-(2-ethynylphenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine.
| Compound Name | 2-(2-ethynylphenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine |
|---|---|
| PubChem CID | 139255937 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(2-ethynylphenyl)-1-(4-methylphenyl)sulfonyl-3-phenylaziridine |
| SMILES | C#Cc1ccccc1C1C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H19NO2S/c1-3-18-9-7-8-12-21(18)23-22(19-10-5-4-6-11-19)24(23)27(25,26)20-15-13-17(2)14-16-20/h1,4-16,22-23H,2H3 |
| InChIKey | QJECFOSREVRSPM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|