C22H21NO3S — CID 135069988
(4S,4'R)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[naphthalene-4,3'-pyrrolidine]-1-one (PubChem CID 135069988) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (4S,4'R)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[naphthalene-4,3'-pyrrolidine]-1-one.
| Compound Name | (4S,4'R)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[naphthalene-4,3'-pyrrolidine]-1-one |
|---|---|
| PubChem CID | 135069988 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (4S,4'R)-4'-ethenyl-1'-(4-methylphenyl)sulfonylspiro[naphthalene-4,3'-pyrrolidine]-1-one |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@]12C=CC(=O)c1ccccc12 |
| InChI | InChI=1S/C22H21NO3S/c1-3-17-14-23(27(25,26)18-10-8-16(2)9-11-18)15-22(17)13-12-21(24)19-6-4-5-7-20(19)22/h3-13,17H,1,14-15H2,2H3/t17-,22-/m0/s1 |
| InChIKey | XFGXELHDJGJITE-JTSKRJEESA-N |
| XLogP | 3.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|