C24H26N2O2S — CID 176730431
N-[(4-methylphenyl)methyl]-1-(4-methylphenyl)sulfonyl-3-phenylazetidin-3-amine (PubChem CID 176730431) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-1-(4-methylphenyl)sulfonyl-3-phenylazetidin-3-amine.
| Compound Name | N-[(4-methylphenyl)methyl]-1-(4-methylphenyl)sulfonyl-3-phenylazetidin-3-amine |
|---|---|
| PubChem CID | 176730431 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-1-(4-methylphenyl)sulfonyl-3-phenylazetidin-3-amine |
| SMILES | Cc1ccc(CNC2(c3ccccc3)CN(S(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-19-8-12-21(13-9-19)16-25-24(22-6-4-3-5-7-22)17-26(18-24)29(27,28)23-14-10-20(2)11-15-23/h3-15,25H,16-18H2,1-2H3 |
| InChIKey | PGBAAFNZMHEABX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |