C16H21NO2S — CID 22200862
1-(4-butylphenyl)sulfonyl-2,4-dimethylpyrrole (PubChem CID 22200862) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-2,4-dimethylpyrrole.
| Compound Name | 1-(4-butylphenyl)sulfonyl-2,4-dimethylpyrrole |
|---|---|
| PubChem CID | 22200862 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-2,4-dimethylpyrrole |
| SMILES | CCCCc1ccc(S(=O)(=O)n2cc(C)cc2C)cc1 |
| InChI | InChI=1S/C16H21NO2S/c1-4-5-6-15-7-9-16(10-8-15)20(18,19)17-12-13(2)11-14(17)3/h7-12H,4-6H2,1-3H3 |
| InChIKey | JFRQOXMUNNFHMS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |