C17H25N3O2S — CID 22204130
4-butyl-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide (PubChem CID 22204130) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-butyl-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-butyl-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 22204130 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-butyl-N-[(1-ethylpyrazol-4-yl)methyl]-N-methylbenzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)N(C)Cc2cnn(CC)c2)cc1 |
| InChI | InChI=1S/C17H25N3O2S/c1-4-6-7-15-8-10-17(11-9-15)23(21,22)19(3)13-16-12-18-20(5-2)14-16/h8-12,14H,4-7,13H2,1-3H3 |
| InChIKey | JOVZUXMOMYEKHO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |