C17H24N4O2S — CID 154782315
N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 154782315) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 154782315 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-methyl-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | CCn1cc(CN(C)c2ccc(S(=O)(=O)N3CCCC3)cc2)cn1 |
| InChI | InChI=1S/C17H24N4O2S/c1-3-20-14-15(12-18-20)13-19(2)16-6-8-17(9-7-16)24(22,23)21-10-4-5-11-21/h6-9,12,14H,3-5,10-11,13H2,1-2H3 |
| InChIKey | BEGCZSYDUHKEEJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |