C17H22N2O2S — CID 3771750
4-butyl-N-(4,6-dimethyl-2-pyridinyl)benzenesulfonamide (PubChem CID 3771750) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-butyl-N-(4,6-dimethyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-butyl-N-(4,6-dimethyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3771750 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-butyl-N-(4,6-dimethyl-2-pyridinyl)benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-4-5-6-15-7-9-16(10-8-15)22(20,21)19-17-12-13(2)11-14(3)18-17/h7-12H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | CXDHKWWOTAXLMA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |