C18H17F6NO2S — CID 22775272
N-[3,5-bis(trifluoromethyl)phenyl]-4-butylbenzenesulfonamide (PubChem CID 22775272) has the molecular formula C18H17F6NO2S and a molecular weight of 425.39 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-butylbenzenesulfonamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 22775272 |
| Molecular Formula | C18H17F6NO2S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-butylbenzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H17F6NO2S/c1-2-3-4-12-5-7-16(8-6-12)28(26,27)25-15-10-13(17(19,20)21)9-14(11-15)18(22,23)24/h5-11,25H,2-4H2,1H3 |
| InChIKey | BZVKSYQMLKUZDQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |