C21H24N4O5S2 — CID 6413238
4-butyl-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 6413238) has the molecular formula C21H24N4O5S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-butyl-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-butyl-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6413238 |
| Molecular Formula | C21H24N4O5S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-butyl-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(OC)nn3)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O5S2/c1-3-4-5-16-6-10-18(11-7-16)31(26,27)24-17-8-12-19(13-9-17)32(28,29)25-20-14-15-21(30-2)23-22-20/h6-15,24H,3-5H2,1-2H3,(H,22,25) |
| InChIKey | LAOUCDJTVAVEEU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |