C13H13IN2O2S — CID 4992211
N-(4,6-dimethyl-2-pyridinyl)-4-iodobenzenesulfonamide (PubChem CID 4992211) has the molecular formula C13H13IN2O2S and a molecular weight of 388.23 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-iodobenzenesulfonamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 4992211 |
| Molecular Formula | C13H13IN2O2S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-iodobenzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C13H13IN2O2S/c1-9-7-10(2)15-13(8-9)16-19(17,18)12-5-3-11(14)4-6-12/h3-8H,1-2H3,(H,15,16) |
| InChIKey | BNPYAIDIXIIYBN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|