C14H15N3O2S2 — CID 114932530
3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide (PubChem CID 114932530) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 114932530 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2cccc(C(N)=S)c2)c1 |
| InChI | InChI=1S/C14H15N3O2S2/c1-9-6-10(2)16-13(7-9)17-21(18,19)12-5-3-4-11(8-12)14(15)20/h3-8H,1-2H3,(H2,15,20)(H,16,17) |
| InChIKey | BAHUOYKHXVLVJG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|