About 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide
3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide (PubChem CID 114932530) has the molecular formula C14H15N3O2S2
and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide |
| PubChem CID | 114932530 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2cccc(C(N)=S)c2)c1 |
| InChI | InChI=1S/C14H15N3O2S2/c1-9-6-10(2)16-13(7-9)17-21(18,19)12-5-3-4-11(8-12)14(15)20/h3-8H,1-2H3,(H2,15,20)(H,16,17) |
| InChIKey | BAHUOYKHXVLVJG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide?
The IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide (CID 114932530) is 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide.
What is the SMILES notation for 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide?
The canonical SMILES for 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide is Cc1cc(C)nc(NS(=O)(=O)c2cccc(C(N)=S)c2)c1.
What is the InChIKey of 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide?
The InChIKey is BAHUOYKHXVLVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2S2/c1-9-6-10(2)16-13(7-9)17-21(18,19)12-5-3-4-11(8-12)14(15)20/h3-8H,1-2H3,(H2,15,20)(H,16,17).
What are the key properties of 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide?
3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide has a molecular weight of 321.43 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethyl-2-pyridinyl)sulfamoyl]benzenecarbothioamide is sourced from PubChem (CID 114932530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).